C20H33N3O4 — CID 22260478
tert-butyl N-[1-[(4-cyanooxan-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]carbamate (PubChem CID 22260478) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl N-[1-[(4-cyanooxan-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(4-cyanooxan-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 22260478 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | tert-butyl N-[1-[(4-cyanooxan-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC1CCCCC1)C(=O)NC1(C#N)CCOCC1 |
| InChI | InChI=1S/C20H33N3O4/c1-19(2,3)27-18(25)22-16(13-15-7-5-4-6-8-15)17(24)23-20(14-21)9-11-26-12-10-20/h15-16H,4-13H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | NXNLVELQTPABEW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |