C22H21F5N2O5 — CID 22261413
tert-butyl 5-(6-fluoro-2-pyridinyl)-2-oxo-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 22261413) has the molecular formula C22H21F5N2O5 and a molecular weight of 488.41 g/mol. Its IUPAC name is tert-butyl 5-(6-fluoro-2-pyridinyl)-2-oxo-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 5-(6-fluoro-2-pyridinyl)-2-oxo-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 22261413 |
| Molecular Formula | C22H21F5N2O5 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | tert-butyl 5-(6-fluoro-2-pyridinyl)-2-oxo-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)OC(c2cccc(F)n2)C1Cc1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C22H21F5N2O5/c1-21(2,3)34-20(31)29-15(17(32-19(29)30)14-8-5-9-16(23)28-14)11-12-6-4-7-13(10-12)33-22(26,27)18(24)25/h4-10,15,17-18H,11H2,1-3H3 |
| InChIKey | XKAXBABRTMWKHQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|