C25H21F4NO4 — CID 22261541
5-(3-phenylmethoxyphenyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 22261541) has the molecular formula C25H21F4NO4 and a molecular weight of 475.44 g/mol. Its IUPAC name is 5-(3-phenylmethoxyphenyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(3-phenylmethoxyphenyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22261541 |
| Molecular Formula | C25H21F4NO4 |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 5-(3-phenylmethoxyphenyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(Cc2cccc(OC(F)(F)C(F)F)c2)C(c2cccc(OCc3ccccc3)c2)O1 |
| InChI | InChI=1S/C25H21F4NO4/c26-23(27)25(28,29)34-20-11-4-8-17(12-20)13-21-22(33-24(31)30-21)18-9-5-10-19(14-18)32-15-16-6-2-1-3-7-16/h1-12,14,21-23H,13,15H2,(H,30,31) |
| InChIKey | XCLKGWZCVRTTHL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|