C23H18F4N2O4 — CID 22261571
5-(5-phenoxy-2-pyridinyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 22261571) has the molecular formula C23H18F4N2O4 and a molecular weight of 462.40 g/mol. Its IUPAC name is 5-(5-phenoxy-2-pyridinyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(5-phenoxy-2-pyridinyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22261571 |
| Molecular Formula | C23H18F4N2O4 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 5-(5-phenoxy-2-pyridinyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(Cc2cccc(OC(F)(F)C(F)F)c2)C(c2ccc(Oc3ccccc3)cn2)O1 |
| InChI | InChI=1S/C23H18F4N2O4/c24-21(25)23(26,27)33-16-8-4-5-14(11-16)12-19-20(32-22(30)29-19)18-10-9-17(13-28-18)31-15-6-2-1-3-7-15/h1-11,13,19-21H,12H2,(H,29,30) |
| InChIKey | BICSOKCNNOEIJX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|