C19H16F5NO3 — CID 22261612
5-(4-fluorophenyl)-4-[[3-methyl-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 22261612) has the molecular formula C19H16F5NO3 and a molecular weight of 401.33 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-[[3-methyl-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(4-fluorophenyl)-4-[[3-methyl-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22261612 |
| Molecular Formula | C19H16F5NO3 |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 5-(4-fluorophenyl)-4-[[3-methyl-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1cc(CC2NC(=O)OC2c2ccc(F)cc2)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C19H16F5NO3/c1-10-6-11(8-14(7-10)28-19(23,24)17(21)22)9-15-16(27-18(26)25-15)12-2-4-13(20)5-3-12/h2-8,15-17H,9H2,1H3,(H,25,26) |
| InChIKey | VRFQAHHROKRZDC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|