C17H13ClF4N2O3 — CID 22261760
5-(6-chloro-3-pyridinyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 22261760) has the molecular formula C17H13ClF4N2O3 and a molecular weight of 404.75 g/mol. Its IUPAC name is 5-(6-chloro-3-pyridinyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(6-chloro-3-pyridinyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22261760 |
| Molecular Formula | C17H13ClF4N2O3 |
| Molecular Weight | 404.75 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 5-(6-chloro-3-pyridinyl)-4-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(Cc2cccc(OC(F)(F)C(F)F)c2)C(c2ccc(Cl)nc2)O1 |
| InChI | InChI=1S/C17H13ClF4N2O3/c18-13-5-4-10(8-23-13)14-12(24-16(25)26-14)7-9-2-1-3-11(6-9)27-17(21,22)15(19)20/h1-6,8,12,14-15H,7H2,(H,24,25) |
| InChIKey | WIPCUJFHRNQXKH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.75 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|