C20H15F5O5 — CID 22261776
ethyl 3-(4-fluorophenyl)-3-oxo-2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methyl]propanoate (PubChem CID 22261776) has the molecular formula C20H15F5O5 and a molecular weight of 430.33 g/mol. Its IUPAC name is ethyl 3-(4-fluorophenyl)-3-oxo-2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methyl]propanoate.
| Compound Name | ethyl 3-(4-fluorophenyl)-3-oxo-2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methyl]propanoate |
|---|---|
| PubChem CID | 22261776 |
| Molecular Formula | C20H15F5O5 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | ethyl 3-(4-fluorophenyl)-3-oxo-2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc2c(c1)OC(F)(F)C(F)(F)O2)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15F5O5/c1-2-28-18(27)14(17(26)12-4-6-13(21)7-5-12)9-11-3-8-15-16(10-11)30-20(24,25)19(22,23)29-15/h3-8,10,14H,2,9H2,1H3 |
| InChIKey | HTYFXQJRHGEDQP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|