C19H15ClF5NO2 — CID 22261848
5-(3-chlorophenyl)-4-[[4-(2,2,3,3,3-pentafluoropropyl)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 22261848) has the molecular formula C19H15ClF5NO2 and a molecular weight of 419.78 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-4-[[4-(2,2,3,3,3-pentafluoropropyl)phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(3-chlorophenyl)-4-[[4-(2,2,3,3,3-pentafluoropropyl)phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22261848 |
| Molecular Formula | C19H15ClF5NO2 |
| Molecular Weight | 419.78 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 5-(3-chlorophenyl)-4-[[4-(2,2,3,3,3-pentafluoropropyl)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(Cc2ccc(CC(F)(F)C(F)(F)F)cc2)C(c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C19H15ClF5NO2/c20-14-3-1-2-13(9-14)16-15(26-17(27)28-16)8-11-4-6-12(7-5-11)10-18(21,22)19(23,24)25/h1-7,9,15-16H,8,10H2,(H,26,27) |
| InChIKey | MQRWNFKUQHNYMG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.78 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|