C62H54F10N2O8 — CID 22261863
bis[2-(8,9-dihydro-7H-benzo[7]annulene-4-carbonylamino)-1-(4-fluorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl] butanedioate (PubChem CID 22261863) has the molecular formula C62H54F10N2O8 and a molecular weight of 1145.10 g/mol. Its IUPAC name is bis[2-(8,9-dihydro-7H-benzo[7]annulene-4-carbonylamino)-1-(4-fluorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl] butanedioate.
| Compound Name | bis[2-(8,9-dihydro-7H-benzo[7]annulene-4-carbonylamino)-1-(4-fluorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl] butanedioate |
|---|---|
| PubChem CID | 22261863 |
| Molecular Formula | C62H54F10N2O8 |
| Molecular Weight | 1145.10 g/mol |
| Exact Mass | 1144.37 |
| IUPAC Name | bis[2-(8,9-dihydro-7H-benzo[7]annulene-4-carbonylamino)-1-(4-fluorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl] butanedioate |
| SMILES | O=C(CCC(=O)OC(c1ccc(F)cc1)C(Cc1cccc(OC(F)(F)C(F)F)c1)NC(=O)c1cccc2c1C=CCCC2)OC(c1ccc(F)cc1)C(Cc1cccc(OC(F)(F)C(F)F)c1)NC(=O)c1cccc2c1C=CCCC2 |
| InChI | InChI=1S/C62H54F10N2O8/c63-43-27-23-41(24-28-43)55(51(35-37-11-7-17-45(33-37)81-61(69,70)59(65)66)73-57(77)49-21-9-15-39-13-3-1-5-19-47(39)49)79-53(75)31-32-54(76)80-56(42-25-29-44(64)30-26-42)52(36-38-12-8-18-46(34-38)82-62(71,72)60(67)68)74-58(78)50-22-10-16-40-14-4-2-6-20-48(40)50/h5-12,15-30,33-34,51-52,55-56,59-60H,1-4,13-14,31-32,35-36H2,(H,73,77)(H,74,78) |
| InChIKey | LVUGYPKLHLJBNR-UHFFFAOYSA-N |
| XLogP | 13.87 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1145.10 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|