C21H23F5N2O4 — CID 22261943
tert-butyl-[1-(6-fluoro-2-pyridinyl)-1-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]carbamic acid (PubChem CID 22261943) has the molecular formula C21H23F5N2O4 and a molecular weight of 462.42 g/mol. Its IUPAC name is tert-butyl-[1-(6-fluoro-2-pyridinyl)-1-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[1-(6-fluoro-2-pyridinyl)-1-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 22261943 |
| Molecular Formula | C21H23F5N2O4 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | tert-butyl-[1-(6-fluoro-2-pyridinyl)-1-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C(Cc1cccc(OC(F)(F)C(F)F)c1)C(O)c1cccc(F)n1 |
| InChI | InChI=1S/C21H23F5N2O4/c1-20(2,3)28(19(30)31)15(17(29)14-8-5-9-16(22)27-14)11-12-6-4-7-13(10-12)32-21(25,26)18(23)24/h4-10,15,17-18,29H,11H2,1-3H3,(H,30,31) |
| InChIKey | UFNCRZLRUQQYRB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|