C18H18F5NO — CID 22261956
2-amino-1-(4-fluorophenyl)-3-[3-(2,2,3,3-tetrafluoropropyl)phenyl]propan-1-ol (PubChem CID 22261956) has the molecular formula C18H18F5NO and a molecular weight of 359.34 g/mol. Its IUPAC name is 2-amino-1-(4-fluorophenyl)-3-[3-(2,2,3,3-tetrafluoropropyl)phenyl]propan-1-ol.
| Compound Name | 2-amino-1-(4-fluorophenyl)-3-[3-(2,2,3,3-tetrafluoropropyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 22261956 |
| Molecular Formula | C18H18F5NO |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-amino-1-(4-fluorophenyl)-3-[3-(2,2,3,3-tetrafluoropropyl)phenyl]propan-1-ol |
| SMILES | NC(Cc1cccc(CC(F)(F)C(F)F)c1)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18F5NO/c19-14-6-4-13(5-7-14)16(25)15(24)9-11-2-1-3-12(8-11)10-18(22,23)17(20)21/h1-8,15-17,25H,9-10,24H2 |
| InChIKey | NLFGHIRLYMXZEY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|