C17H15F5N2O4 — CID 22261961
[1-(4-fluorophenyl)-1-hydroxy-3-[6-(1,1,2,2-tetrafluoroethoxy)-2-pyridinyl]propan-2-yl]carbamic acid (PubChem CID 22261961) has the molecular formula C17H15F5N2O4 and a molecular weight of 406.31 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-1-hydroxy-3-[6-(1,1,2,2-tetrafluoroethoxy)-2-pyridinyl]propan-2-yl]carbamic acid.
| Compound Name | [1-(4-fluorophenyl)-1-hydroxy-3-[6-(1,1,2,2-tetrafluoroethoxy)-2-pyridinyl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 22261961 |
| Molecular Formula | C17H15F5N2O4 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [1-(4-fluorophenyl)-1-hydroxy-3-[6-(1,1,2,2-tetrafluoroethoxy)-2-pyridinyl]propan-2-yl]carbamic acid |
| SMILES | O=C(O)NC(Cc1cccc(OC(F)(F)C(F)F)n1)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15F5N2O4/c18-10-6-4-9(5-7-10)14(25)12(24-16(26)27)8-11-2-1-3-13(23-11)28-17(21,22)15(19)20/h1-7,12,14-15,24-25H,8H2,(H,26,27) |
| InChIKey | DDEKAJUBYNPEPD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|