C23H25ClF2O3 — CID 22262034
ethyl 3-(3-chlorophenyl)-2-[[4-(1,1-difluoro-2,2-dimethylpropyl)phenyl]methyl]-3-oxopropanoate (PubChem CID 22262034) has the molecular formula C23H25ClF2O3 and a molecular weight of 422.90 g/mol. Its IUPAC name is ethyl 3-(3-chlorophenyl)-2-[[4-(1,1-difluoro-2,2-dimethylpropyl)phenyl]methyl]-3-oxopropanoate.
| Compound Name | ethyl 3-(3-chlorophenyl)-2-[[4-(1,1-difluoro-2,2-dimethylpropyl)phenyl]methyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 22262034 |
| Molecular Formula | C23H25ClF2O3 |
| Molecular Weight | 422.90 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | ethyl 3-(3-chlorophenyl)-2-[[4-(1,1-difluoro-2,2-dimethylpropyl)phenyl]methyl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(Cc1ccc(C(F)(F)C(C)(C)C)cc1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H25ClF2O3/c1-5-29-21(28)19(20(27)16-7-6-8-18(24)14-16)13-15-9-11-17(12-10-15)23(25,26)22(2,3)4/h6-12,14,19H,5,13H2,1-4H3 |
| InChIKey | ROENZYBOXDNLJA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.90 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|