About 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one
5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 22262075) has the molecular formula C16H12ClF3N2O2
and a molecular weight of 356.73 g/mol. Its IUPAC name is 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one |
| PubChem CID | 22262075 |
| Molecular Formula | C16H12ClF3N2O2 |
| Molecular Weight | 356.73 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(Cc2ccc(C(F)(F)F)cc2)C(c2cccc(Cl)n2)O1 |
| InChI | InChI=1S/C16H12ClF3N2O2/c17-13-3-1-2-11(21-13)14-12(22-15(23)24-14)8-9-4-6-10(7-5-9)16(18,19)20/h1-7,12,14H,8H2,(H,22,23) |
| InChIKey | IHVCSWODUUJEJV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.73 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one?
The IUPAC name of 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one (CID 22262075) is 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one is O=C1NC(Cc2ccc(C(F)(F)F)cc2)C(c2cccc(Cl)n2)O1.
What is the InChIKey of 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one?
The InChIKey is IHVCSWODUUJEJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClF3N2O2/c17-13-3-1-2-11(21-13)14-12(22-15(23)24-14)8-9-4-6-10(7-5-9)16(18,19)20/h1-7,12,14H,8H2,(H,22,23).
What are the key properties of 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one?
5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one has a molecular weight of 356.73 g/mol, XLogP of 4.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-chloro-2-pyridinyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 22262075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).