C17H13F5N2O3 — CID 22262221
5-(4-fluorophenyl)-4-[[6-(1,1,2,2-tetrafluoroethoxy)-2-pyridinyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 22262221) has the molecular formula C17H13F5N2O3 and a molecular weight of 388.29 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-[[6-(1,1,2,2-tetrafluoroethoxy)-2-pyridinyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(4-fluorophenyl)-4-[[6-(1,1,2,2-tetrafluoroethoxy)-2-pyridinyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22262221 |
| Molecular Formula | C17H13F5N2O3 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 5-(4-fluorophenyl)-4-[[6-(1,1,2,2-tetrafluoroethoxy)-2-pyridinyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(Cc2cccc(OC(F)(F)C(F)F)n2)C(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C17H13F5N2O3/c18-10-6-4-9(5-7-10)14-12(24-16(25)26-14)8-11-2-1-3-13(23-11)27-17(21,22)15(19)20/h1-7,12,14-15H,8H2,(H,24,25) |
| InChIKey | MBFONRXYYONMMN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|