C19H17ClF5NO3 — CID 22262290
[1-(3-chlorophenyl)-1-hydroxy-3-[4-(2,2,3,3,3-pentafluoropropyl)phenyl]propan-2-yl]carbamic acid (PubChem CID 22262290) has the molecular formula C19H17ClF5NO3 and a molecular weight of 437.79 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-1-hydroxy-3-[4-(2,2,3,3,3-pentafluoropropyl)phenyl]propan-2-yl]carbamic acid.
| Compound Name | [1-(3-chlorophenyl)-1-hydroxy-3-[4-(2,2,3,3,3-pentafluoropropyl)phenyl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 22262290 |
| Molecular Formula | C19H17ClF5NO3 |
| Molecular Weight | 437.79 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | [1-(3-chlorophenyl)-1-hydroxy-3-[4-(2,2,3,3,3-pentafluoropropyl)phenyl]propan-2-yl]carbamic acid |
| SMILES | O=C(O)NC(Cc1ccc(CC(F)(F)C(F)(F)F)cc1)C(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClF5NO3/c20-14-3-1-2-13(9-14)16(27)15(26-17(28)29)8-11-4-6-12(7-5-11)10-18(21,22)19(23,24)25/h1-7,9,15-16,26-27H,8,10H2,(H,28,29) |
| InChIKey | KQTPBZDYSLZHGH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.79 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|