C36H36N2O9 — CID 22262732
2-amino-N-benzyl-N-methyl-2-phenylacetamide;2,3-dihydroxy-2,3-bis(2-methylbenzoyl)butanedioic acid (PubChem CID 22262732) has the molecular formula C36H36N2O9 and a molecular weight of 640.69 g/mol. Its IUPAC name is 2-amino-N-benzyl-N-methyl-2-phenylacetamide;2,3-dihydroxy-2,3-bis(2-methylbenzoyl)butanedioic acid.
| Compound Name | 2-amino-N-benzyl-N-methyl-2-phenylacetamide;2,3-dihydroxy-2,3-bis(2-methylbenzoyl)butanedioic acid |
|---|---|
| PubChem CID | 22262732 |
| Molecular Formula | C36H36N2O9 |
| Molecular Weight | 640.69 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | 2-amino-N-benzyl-N-methyl-2-phenylacetamide;2,3-dihydroxy-2,3-bis(2-methylbenzoyl)butanedioic acid |
| SMILES | CN(Cc1ccccc1)C(=O)C(N)c1ccccc1.Cc1ccccc1C(=O)C(O)(C(=O)O)C(O)(C(=O)O)C(=O)c1ccccc1C |
| InChI | InChI=1S/C20H18O8.C16H18N2O/c1-11-7-3-5-9-13(11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-10-6-4-8-12(14)2;1-18(12-13-8-4-2-5-9-13)16(19)15(17)14-10-6-3-7-11-14/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26);2-11,15H,12,17H2,1H3 |
| InChIKey | XXEXAERJXUGXBC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 195.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.69 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|