C18H17ClN4OS — CID 22262839
2-[(6-chloro-2-pyridinyl)amino]-N-(2,4,6-trimethylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 22262839) has the molecular formula C18H17ClN4OS and a molecular weight of 372.88 g/mol. Its IUPAC name is 2-[(6-chloro-2-pyridinyl)amino]-N-(2,4,6-trimethylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(6-chloro-2-pyridinyl)amino]-N-(2,4,6-trimethylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 22262839 |
| Molecular Formula | C18H17ClN4OS |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-[(6-chloro-2-pyridinyl)amino]-N-(2,4,6-trimethylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2cnc(Nc3cccc(Cl)n3)s2)c(C)c1 |
| InChI | InChI=1S/C18H17ClN4OS/c1-10-7-11(2)16(12(3)8-10)23-17(24)13-9-20-18(25-13)22-15-6-4-5-14(19)21-15/h4-9H,1-3H3,(H,23,24)(H,20,21,22) |
| InChIKey | BVSKIMCXJWEGEJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|