About 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole
4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole (PubChem CID 22262905) has the molecular formula C15H18ClN3O2S
and a molecular weight of 339.85 g/mol. Its IUPAC name is 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole.
Molecular Properties
| Compound Name | 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole |
| PubChem CID | 22262905 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole |
| SMILES | CCCS(=O)(=O)n1cc(CC2=NCCN2)c2c(Cl)cccc21 |
| InChI | InChI=1S/C15H18ClN3O2S/c1-2-8-22(20,21)19-10-11(9-14-17-6-7-18-14)15-12(16)4-3-5-13(15)19/h3-5,10H,2,6-9H2,1H3,(H,17,18) |
| InChIKey | AMACTCXMMCMSMQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole?
The IUPAC name of 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole (CID 22262905) is 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole.
What is the SMILES notation for 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole?
The canonical SMILES for 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole is CCCS(=O)(=O)n1cc(CC2=NCCN2)c2c(Cl)cccc21.
What is the InChIKey of 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole?
The InChIKey is AMACTCXMMCMSMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3O2S/c1-2-8-22(20,21)19-10-11(9-14-17-6-7-18-14)15-12(16)4-3-5-13(15)19/h3-5,10H,2,6-9H2,1H3,(H,17,18).
What are the key properties of 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole?
4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole has a molecular weight of 339.85 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-1-propylsulfonylindole is sourced from PubChem (CID 22262905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).