About 4-(4-aminophenyl)-2,3-dimethoxyaniline
4-(4-aminophenyl)-2,3-dimethoxyaniline (PubChem CID 22263334) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,3-dimethoxyaniline.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)-2,3-dimethoxyaniline |
| PubChem CID | 22263334 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-(4-aminophenyl)-2,3-dimethoxyaniline |
| SMILES | COc1c(N)ccc(-c2ccc(N)cc2)c1OC |
| InChI | InChI=1S/C14H16N2O2/c1-17-13-11(7-8-12(16)14(13)18-2)9-3-5-10(15)6-4-9/h3-8H,15-16H2,1-2H3 |
| InChIKey | XVHOSCGFZMMVNL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)-2,3-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)-2,3-dimethoxyaniline?
The IUPAC name of 4-(4-aminophenyl)-2,3-dimethoxyaniline (CID 22263334) is 4-(4-aminophenyl)-2,3-dimethoxyaniline.
What is the SMILES notation for 4-(4-aminophenyl)-2,3-dimethoxyaniline?
The canonical SMILES for 4-(4-aminophenyl)-2,3-dimethoxyaniline is COc1c(N)ccc(-c2ccc(N)cc2)c1OC.
What is the InChIKey of 4-(4-aminophenyl)-2,3-dimethoxyaniline?
The InChIKey is XVHOSCGFZMMVNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2/c1-17-13-11(7-8-12(16)14(13)18-2)9-3-5-10(15)6-4-9/h3-8H,15-16H2,1-2H3.
What are the key properties of 4-(4-aminophenyl)-2,3-dimethoxyaniline?
4-(4-aminophenyl)-2,3-dimethoxyaniline has a molecular weight of 244.29 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)-2,3-dimethoxyaniline is sourced from PubChem (CID 22263334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).