C23H27FN2O4 — CID 22264317
4-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-2-methoxybenzaldehyde (PubChem CID 22264317) has the molecular formula C23H27FN2O4 and a molecular weight of 414.48 g/mol. Its IUPAC name is 4-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-2-methoxybenzaldehyde.
| Compound Name | 4-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-2-methoxybenzaldehyde |
|---|---|
| PubChem CID | 22264317 |
| Molecular Formula | C23H27FN2O4 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 4-[2-[4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]-2-methoxybenzaldehyde |
| SMILES | COc1cc(OCC(=O)N2CC(C)N(Cc3ccc(F)cc3)CC2C)ccc1C=O |
| InChI | InChI=1S/C23H27FN2O4/c1-16-12-26(17(2)11-25(16)13-18-4-7-20(24)8-5-18)23(28)15-30-21-9-6-19(14-27)22(10-21)29-3/h4-10,14,16-17H,11-13,15H2,1-3H3 |
| InChIKey | HOJCMQGZHVCVOY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|