C20H24N2O3S2 — CID 2226544
(2S)-1-(benzenesulfonyl)-N-[2-(4-methylphenyl)sulfanylethyl]pyrrolidine-2-carboxamide (PubChem CID 2226544) has the molecular formula C20H24N2O3S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is (2S)-1-(benzenesulfonyl)-N-[2-(4-methylphenyl)sulfanylethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(benzenesulfonyl)-N-[2-(4-methylphenyl)sulfanylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 2226544 |
| Molecular Formula | C20H24N2O3S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (2S)-1-(benzenesulfonyl)-N-[2-(4-methylphenyl)sulfanylethyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(SCCNC(=O)[C@@H]2CCCN2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O3S2/c1-16-9-11-17(12-10-16)26-15-13-21-20(23)19-8-5-14-22(19)27(24,25)18-6-3-2-4-7-18/h2-4,6-7,9-12,19H,5,8,13-15H2,1H3,(H,21,23)/t19-/m0/s1 |
| InChIKey | SUOLVWMEEZSFBG-IBGZPJMESA-N |
| XLogP | 3.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|