About (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride
(6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride (PubChem CID 22266) has the molecular formula C21H28ClNO
and a molecular weight of 345.91 g/mol. Its IUPAC name is (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride.
Molecular Properties
| Compound Name | (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride |
| PubChem CID | 22266 |
| Molecular Formula | C21H28ClNO |
| Molecular Weight | 345.91 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride |
| SMILES | CCC(=O)C(C[C@@H](C)N(C)C)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H27NO.ClH/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6-15,17H,5,16H2,1-4H3;1H/t17-;/m1./s1 |
| InChIKey | FJQXCDYVZAHXNS-UNTBIKODSA-N |
| XLogP | 4.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.91 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride?
The IUPAC name of (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride (CID 22266) is (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride.
What is the SMILES notation for (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride?
The canonical SMILES for (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride is CCC(=O)C(C[C@@H](C)N(C)C)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride?
The InChIKey is FJQXCDYVZAHXNS-UNTBIKODSA-N. The full InChI is InChI=1S/C21H27NO.ClH/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6-15,17H,5,16H2,1-4H3;1H/t17-;/m1./s1.
What are the key properties of (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride?
(6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride has a molecular weight of 345.91 g/mol, XLogP of 4.71, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride is sourced from PubChem (CID 22266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).