C24H21F6N6O5P — CID 22266797
[2-(2,4-difluorophenyl)-1-[3-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-1,2,4-triazol-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-yl] dihydrogen phosphate (PubChem CID 22266797) has the molecular formula C24H21F6N6O5P and a molecular weight of 618.43 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)-1-[3-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-1,2,4-triazol-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-yl] dihydrogen phosphate.
| Compound Name | [2-(2,4-difluorophenyl)-1-[3-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-1,2,4-triazol-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 22266797 |
| Molecular Formula | C24H21F6N6O5P |
| Molecular Weight | 618.43 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | [2-(2,4-difluorophenyl)-1-[3-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-1,2,4-triazol-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC(Cn1cncn1)(Cn1cnc(/C=C/c2ccc(OCC(F)(F)C(F)F)cc2)n1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H21F6N6O5P/c25-17-4-7-19(20(26)9-17)23(41-42(37,38)39,10-35-14-31-13-33-35)11-36-15-32-21(34-36)8-3-16-1-5-18(6-2-16)40-12-24(29,30)22(27)28/h1-9,13-15,22H,10-12H2,(H2,37,38,39)/b8-3+ |
| InChIKey | ZVSDDJULTOGFOX-FPYGCLRLSA-N |
| XLogP | 4.30 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|