C21H27ClN4O6 — CID 22267537
2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[4-(2,3-dihydroxypropyl)-3,5-dioxo-1,2,4-triazin-2-yl]benzamide (PubChem CID 22267537) has the molecular formula C21H27ClN4O6 and a molecular weight of 466.92 g/mol. Its IUPAC name is 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[4-(2,3-dihydroxypropyl)-3,5-dioxo-1,2,4-triazin-2-yl]benzamide.
| Compound Name | 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[4-(2,3-dihydroxypropyl)-3,5-dioxo-1,2,4-triazin-2-yl]benzamide |
|---|---|
| PubChem CID | 22267537 |
| Molecular Formula | C21H27ClN4O6 |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[4-(2,3-dihydroxypropyl)-3,5-dioxo-1,2,4-triazin-2-yl]benzamide |
| SMILES | O=C(NC(O)C1CCCCCC1)c1cc(-n2ncc(=O)n(CC(O)CO)c2=O)ccc1Cl |
| InChI | InChI=1S/C21H27ClN4O6/c22-17-8-7-14(26-21(32)25(11-15(28)12-27)18(29)10-23-26)9-16(17)20(31)24-19(30)13-5-3-1-2-4-6-13/h7-10,13,15,19,27-28,30H,1-6,11-12H2,(H,24,31) |
| InChIKey | BKHFIPTXKOPROA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|