C7H10N2O — CID 22268054
1,3,3a,4,7,7a-hexahydrobenzimidazol-2-one (PubChem CID 22268054) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 1,3,3a,4,7,7a-hexahydrobenzimidazol-2-one.
| Compound Name | 1,3,3a,4,7,7a-hexahydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 22268054 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 1,3,3a,4,7,7a-hexahydrobenzimidazol-2-one |
| SMILES | O=C1NC2CC=CCC2N1 |
| InChI | InChI=1S/C7H10N2O/c10-7-8-5-3-1-2-4-6(5)9-7/h1-2,5-6H,3-4H2,(H2,8,9,10) |
| InChIKey | DMFQXXPXKJCBTO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|