About 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one
3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one (PubChem CID 22268260) has the molecular formula C14H8BrF2N3O
and a molecular weight of 352.14 g/mol. Its IUPAC name is 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one.
Molecular Properties
| Compound Name | 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one |
| PubChem CID | 22268260 |
| Molecular Formula | C14H8BrF2N3O |
| Molecular Weight | 352.14 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one |
| SMILES | O=c1cc2ncc(Br)nc2cn1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H8BrF2N3O/c15-13-5-18-11-4-14(21)20(7-12(11)19-13)6-8-1-2-9(16)10(17)3-8/h1-5,7H,6H2 |
| InChIKey | NNEOXDHEYOWHBC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.14 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one?
The IUPAC name of 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one (CID 22268260) is 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one.
What is the SMILES notation for 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one?
The canonical SMILES for 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one is O=c1cc2ncc(Br)nc2cn1Cc1ccc(F)c(F)c1.
What is the InChIKey of 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one?
The InChIKey is NNEOXDHEYOWHBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrF2N3O/c15-13-5-18-11-4-14(21)20(7-12(11)19-13)6-8-1-2-9(16)10(17)3-8/h1-5,7H,6H2.
What are the key properties of 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one?
3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one has a molecular weight of 352.14 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-[(3,4-difluorophenyl)methyl]pyrido[3,4-b]pyrazin-7-one is sourced from PubChem (CID 22268260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).