About 1H-cyclohepta[b]pyridine
1H-cyclohepta[b]pyridine (PubChem CID 22270306) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is 1H-cyclohepta[b]pyridine.
Molecular Properties
| Compound Name | 1H-cyclohepta[b]pyridine |
| PubChem CID | 22270306 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 1H-cyclohepta[b]pyridine |
| SMILES | C1=CC=C2NC=CC=C2C=C1 |
| InChI | InChI=1S/C10H9N/c1-2-5-9-6-4-8-11-10(9)7-3-1/h1-8,11H |
| InChIKey | HCLXLZGAYCTHQJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-cyclohepta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-cyclohepta[b]pyridine?
The IUPAC name of 1H-cyclohepta[b]pyridine (CID 22270306) is 1H-cyclohepta[b]pyridine.
What is the SMILES notation for 1H-cyclohepta[b]pyridine?
The canonical SMILES for 1H-cyclohepta[b]pyridine is C1=CC=C2NC=CC=C2C=C1.
What is the InChIKey of 1H-cyclohepta[b]pyridine?
The InChIKey is HCLXLZGAYCTHQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N/c1-2-5-9-6-4-8-11-10(9)7-3-1/h1-8,11H.
What are the key properties of 1H-cyclohepta[b]pyridine?
1H-cyclohepta[b]pyridine has a molecular weight of 143.19 g/mol, XLogP of 2.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-cyclohepta[b]pyridine is sourced from PubChem (CID 22270306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).