C18H19NO4S — CID 2227042
4-tert-butyl-N-(1-oxo-3H-2-benzofuran-5-yl)benzenesulfonamide (PubChem CID 2227042) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is 4-tert-butyl-N-(1-oxo-3H-2-benzofuran-5-yl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(1-oxo-3H-2-benzofuran-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 2227042 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 4-tert-butyl-N-(1-oxo-3H-2-benzofuran-5-yl)benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3c(c2)COC3=O)cc1 |
| InChI | InChI=1S/C18H19NO4S/c1-18(2,3)13-4-7-15(8-5-13)24(21,22)19-14-6-9-16-12(10-14)11-23-17(16)20/h4-10,19H,11H2,1-3H3 |
| InChIKey | OOMPWWOUDRWLBR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |