C16H18Cl3N — CID 22270427
3,4-bis(4-chlorophenyl)butan-2-amine;hydrochloride (PubChem CID 22270427) has the molecular formula C16H18Cl3N and a molecular weight of 330.69 g/mol. Its IUPAC name is 3,4-bis(4-chlorophenyl)butan-2-amine;hydrochloride.
| Compound Name | 3,4-bis(4-chlorophenyl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 22270427 |
| Molecular Formula | C16H18Cl3N |
| Molecular Weight | 330.69 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 3,4-bis(4-chlorophenyl)butan-2-amine;hydrochloride |
| SMILES | CC(N)C(Cc1ccc(Cl)cc1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C16H17Cl2N.ClH/c1-11(19)16(13-4-8-15(18)9-5-13)10-12-2-6-14(17)7-3-12;/h2-9,11,16H,10,19H2,1H3;1H |
| InChIKey | KHKARPYRYIPKRD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.69 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |