C6H6Cl6 — CID 22272158
1,1,2,2,3,3-hexachlorocyclohexane (PubChem CID 22272158) has the molecular formula C6H6Cl6 and a molecular weight of 290.83 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexachlorocyclohexane.
| Compound Name | 1,1,2,2,3,3-hexachlorocyclohexane |
|---|---|
| PubChem CID | 22272158 |
| Molecular Formula | C6H6Cl6 |
| Molecular Weight | 290.83 g/mol |
| Exact Mass | 287.86 |
| IUPAC Name | 1,1,2,2,3,3-hexachlorocyclohexane |
| SMILES | ClC1(Cl)CCCC(Cl)(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C6H6Cl6/c7-4(8)2-1-3-5(9,10)6(4,11)12/h1-3H2 |
| InChIKey | JCMKNCBLXDQLEA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.83 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|