C31H38FN3O4S — CID 22272344
12-[2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-16-fluoro-9-(2-methylsulfanylethyl)-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione (PubChem CID 22272344) has the molecular formula C31H38FN3O4S and a molecular weight of 567.73 g/mol. Its IUPAC name is 12-[2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-16-fluoro-9-(2-methylsulfanylethyl)-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione.
| Compound Name | 12-[2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-16-fluoro-9-(2-methylsulfanylethyl)-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione |
|---|---|
| PubChem CID | 22272344 |
| Molecular Formula | C31H38FN3O4S |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | 12-[2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-16-fluoro-9-(2-methylsulfanylethyl)-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione |
| SMILES | C#Cc1cccc(C2(NCC(O)C3Cc4cc(F)cc(c4)OCCCCC(=O)NC(CCSC)C(=O)N3)CC2)c1 |
| InChI | InChI=1S/C31H38FN3O4S/c1-3-21-7-6-8-23(15-21)31(11-12-31)33-20-28(36)27-18-22-16-24(32)19-25(17-22)39-13-5-4-9-29(37)34-26(10-14-40-2)30(38)35-27/h1,6-8,15-17,19,26-28,33,36H,4-5,9-14,18,20H2,2H3,(H,34,37)(H,35,38) |
| InChIKey | CCXHULCRCOZGTG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|