About spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane]
spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane] (PubChem CID 22273197) has the molecular formula C11H18
and a molecular weight of 150.26 g/mol. Its IUPAC name is spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane].
Molecular Properties
| Compound Name | spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane] |
| PubChem CID | 22273197 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane] |
| SMILES | C1CCC2(C1)CC1CCC2C1 |
| InChI | InChI=1S/C11H18/c1-2-6-11(5-1)8-9-3-4-10(11)7-9/h9-10H,1-8H2 |
| InChIKey | CHUXSKFZUPTQDX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane]?
The IUPAC name of spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane] (CID 22273197) is spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane].
What is the SMILES notation for spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane]?
The canonical SMILES for spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane] is C1CCC2(C1)CC1CCC2C1.
What is the InChIKey of spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane]?
The InChIKey is CHUXSKFZUPTQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18/c1-2-6-11(5-1)8-9-3-4-10(11)7-9/h9-10H,1-8H2.
What are the key properties of spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane]?
spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane] has a molecular weight of 150.26 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[bicyclo[2.2.1]heptane-2,1'-cyclopentane] is sourced from PubChem (CID 22273197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).