C26H34N6O2 — CID 22273365
2-(3,5-dimethyl-4-quinazolin-4-ylpiperazin-1-yl)-N-[2-methyl-5-[2-(methylamino)ethoxy]phenyl]acetamide (PubChem CID 22273365) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-quinazolin-4-ylpiperazin-1-yl)-N-[2-methyl-5-[2-(methylamino)ethoxy]phenyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-4-quinazolin-4-ylpiperazin-1-yl)-N-[2-methyl-5-[2-(methylamino)ethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 22273365 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 2-(3,5-dimethyl-4-quinazolin-4-ylpiperazin-1-yl)-N-[2-methyl-5-[2-(methylamino)ethoxy]phenyl]acetamide |
| SMILES | CNCCOc1ccc(C)c(NC(=O)CN2CC(C)N(c3ncnc4ccccc34)C(C)C2)c1 |
| InChI | InChI=1S/C26H34N6O2/c1-18-9-10-21(34-12-11-27-4)13-24(18)30-25(33)16-31-14-19(2)32(20(3)15-31)26-22-7-5-6-8-23(22)28-17-29-26/h5-10,13,17,19-20,27H,11-12,14-16H2,1-4H3,(H,30,33) |
| InChIKey | SXDGJJQTDNWHTK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|