About 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate
2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate (PubChem CID 22273379) has the molecular formula C8H13N2O2-
and a molecular weight of 169.20 g/mol. Its IUPAC name is 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate.
Molecular Properties
| Compound Name | 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate |
| PubChem CID | 22273379 |
| Molecular Formula | C8H13N2O2- |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate |
| SMILES | O=C([O-])CN1CC2CCC(C1)N2 |
| InChI | InChI=1S/C8H14N2O2/c11-8(12)5-10-3-6-1-2-7(4-10)9-6/h6-7,9H,1-5H2,(H,11,12)/p-1 |
| InChIKey | NYXSBYFDIPFORX-UHFFFAOYSA-M |
| XLogP | -1.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate?
The IUPAC name of 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate (CID 22273379) is 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate.
What is the SMILES notation for 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate?
The canonical SMILES for 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate is O=C([O-])CN1CC2CCC(C1)N2.
What is the InChIKey of 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate?
The InChIKey is NYXSBYFDIPFORX-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H14N2O2/c11-8(12)5-10-3-6-1-2-7(4-10)9-6/h6-7,9H,1-5H2,(H,11,12)/p-1.
What are the key properties of 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate?
2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate has a molecular weight of 169.20 g/mol, XLogP of -1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,8-diazabicyclo[3.2.1]octan-3-yl)acetate is sourced from PubChem (CID 22273379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).