C19H17FN8O — CID 22273608
N-(4-fluoro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6-(3-methyl-1,2,4-oxadiazol-5-yl)-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 22273608) has the molecular formula C19H17FN8O and a molecular weight of 392.40 g/mol. Its IUPAC name is N-(4-fluoro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6-(3-methyl-1,2,4-oxadiazol-5-yl)-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | N-(4-fluoro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6-(3-methyl-1,2,4-oxadiazol-5-yl)-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 22273608 |
| Molecular Formula | C19H17FN8O |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-(4-fluoro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6-(3-methyl-1,2,4-oxadiazol-5-yl)-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Cc1noc(-c2cn3ncnc(Nc4cnc5[nH]ccc5c4F)c3c2C(C)C)n1 |
| InChI | InChI=1S/C19H17FN8O/c1-9(2)14-12(19-25-10(3)27-29-19)7-28-16(14)18(23-8-24-28)26-13-6-22-17-11(15(13)20)4-5-21-17/h4-9H,1-3H3,(H,21,22)(H,23,24,26) |
| InChIKey | DNLFTHMQMOVEOZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |