About 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol
4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol (PubChem CID 22273619) has the molecular formula C8H7FN2O
and a molecular weight of 166.15 g/mol. Its IUPAC name is 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol.
Molecular Properties
| Compound Name | 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol |
| PubChem CID | 22273619 |
| Molecular Formula | C8H7FN2O |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol |
| SMILES | Cc1cc2c(F)c(O)cnc2[nH]1 |
| InChI | InChI=1S/C8H7FN2O/c1-4-2-5-7(9)6(12)3-10-8(5)11-4/h2-3,12H,1H3,(H,10,11) |
| InChIKey | AXQONGGPBDQSSD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol?
The IUPAC name of 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol (CID 22273619) is 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol.
What is the SMILES notation for 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol?
The canonical SMILES for 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol is Cc1cc2c(F)c(O)cnc2[nH]1.
What is the InChIKey of 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol?
The InChIKey is AXQONGGPBDQSSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN2O/c1-4-2-5-7(9)6(12)3-10-8(5)11-4/h2-3,12H,1H3,(H,10,11).
What are the key properties of 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol?
4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol has a molecular weight of 166.15 g/mol, XLogP of 1.72, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol is sourced from PubChem (CID 22273619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).