About 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine
1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine (PubChem CID 22274451) has the molecular formula C21H21Cl2NO
and a molecular weight of 374.31 g/mol. Its IUPAC name is 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine.
Molecular Properties
| Compound Name | 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine |
| PubChem CID | 22274451 |
| Molecular Formula | C21H21Cl2NO |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine |
| SMILES | CC1CCCN1CCc1cc2cc(-c3ccc(Cl)c(Cl)c3)ccc2o1 |
| InChI | InChI=1S/C21H21Cl2NO/c1-14-3-2-9-24(14)10-8-18-12-17-11-15(5-7-21(17)25-18)16-4-6-19(22)20(23)13-16/h4-7,11-14H,2-3,8-10H2,1H3 |
| InChIKey | KNMDVDZWMCZHKS-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine?
The IUPAC name of 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine (CID 22274451) is 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine.
What is the SMILES notation for 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine?
The canonical SMILES for 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine is CC1CCCN1CCc1cc2cc(-c3ccc(Cl)c(Cl)c3)ccc2o1.
What is the InChIKey of 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine?
The InChIKey is KNMDVDZWMCZHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21Cl2NO/c1-14-3-2-9-24(14)10-8-18-12-17-11-15(5-7-21(17)25-18)16-4-6-19(22)20(23)13-16/h4-7,11-14H,2-3,8-10H2,1H3.
What are the key properties of 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine?
1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine has a molecular weight of 374.31 g/mol, XLogP of 6.43, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[5-(3,4-dichlorophenyl)-1-benzofuran-2-yl]ethyl]-2-methylpyrrolidine is sourced from PubChem (CID 22274451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).