About 4-[(6-{2-[2-(1-Piperidinyl)ethyl]-1-benzofuran-5-yl}-3-pyridinyl)carbonyl]morpholine
4-[(6-{2-[2-(1-Piperidinyl)ethyl]-1-benzofuran-5-yl}-3-pyridinyl)carbonyl]morpholine (PubChem CID 22274469) has the molecular formula C25H29N3O3
and a molecular weight of 419.50 g/mol. Its IUPAC name is morpholin-4-yl-[6-[2-(2-piperidin-1-ylethyl)-1-benzofuran-5-yl]-3-pyridinyl]methanone.
Molecular Properties
| Compound Name | 4-[(6-{2-[2-(1-Piperidinyl)ethyl]-1-benzofuran-5-yl}-3-pyridinyl)carbonyl]morpholine |
| PubChem CID | 22274469 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | morpholin-4-yl-[6-[2-(2-piperidin-1-ylethyl)-1-benzofuran-5-yl]-3-pyridinyl]methanone |
| SMILES | C1CCN(CC1)CCC2=CC3=C(O2)C=CC(=C3)C4=NC=C(C=C4)C(=O)N5CCOCC5 |
| InChI | InChI=1S/C25H29N3O3/c29-25(28-12-14-30-15-13-28)20-4-6-23(26-18-20)19-5-7-24-21(16-19)17-22(31-24)8-11-27-9-2-1-3-10-27/h4-7,16-18H,1-3,8-15H2 |
| InChIKey | XNUIRGHKJISNSI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | 591 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(6-{2-[2-(1-Piperidinyl)ethyl]-1-benzofuran-5-yl}-3-pyridinyl)carbonyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-{2-[2-(1-Piperidinyl)ethyl]-1-benzofuran-5-yl}-3-pyridinyl)carbonyl]morpholine?
The IUPAC name of 4-[(6-{2-[2-(1-Piperidinyl)ethyl]-1-benzofuran-5-yl}-3-pyridinyl)carbonyl]morpholine (CID 22274469) is morpholin-4-yl-[6-[2-(2-piperidin-1-ylethyl)-1-benzofuran-5-yl]-3-pyridinyl]methanone.
What is the SMILES notation for 4-[(6-{2-[2-(1-Piperidinyl)ethyl]-1-benzofuran-5-yl}-3-pyridinyl)carbonyl]morpholine?
The canonical SMILES for 4-[(6-{2-[2-(1-Piperidinyl)ethyl]-1-benzofuran-5-yl}-3-pyridinyl)carbonyl]morpholine is C1CCN(CC1)CCC2=CC3=C(O2)C=CC(=C3)C4=NC=C(C=C4)C(=O)N5CCOCC5.
What is the InChIKey of 4-[(6-{2-[2-(1-Piperidinyl)ethyl]-1-benzofuran-5-yl}-3-pyridinyl)carbonyl]morpholine?
The InChIKey is XNUIRGHKJISNSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O3/c29-25(28-12-14-30-15-13-28)20-4-6-23(26-18-20)19-5-7-24-21(16-19)17-22(31-24)8-11-27-9-2-1-3-10-27/h4-7,16-18H,1-3,8-15H2.
What are the key properties of 4-[(6-{2-[2-(1-Piperidinyl)ethyl]-1-benzofuran-5-yl}-3-pyridinyl)carbonyl]morpholine?
4-[(6-{2-[2-(1-Piperidinyl)ethyl]-1-benzofuran-5-yl}-3-pyridinyl)carbonyl]morpholine has a molecular weight of 419.50 g/mol, XLogP of 3.20, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-{2-[2-(1-Piperidinyl)ethyl]-1-benzofuran-5-yl}-3-pyridinyl)carbonyl]morpholine is sourced from PubChem (CID 22274469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).