C21H21NO4 — CID 22274541
[4-[2-(2-hydroxyethyl)-1-benzofuran-5-yl]phenyl]-morpholin-4-ylmethanone (PubChem CID 22274541) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is [4-[2-(2-hydroxyethyl)-1-benzofuran-5-yl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[2-(2-hydroxyethyl)-1-benzofuran-5-yl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 22274541 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [4-[2-(2-hydroxyethyl)-1-benzofuran-5-yl]phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(-c2ccc3oc(CCO)cc3c2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H21NO4/c23-10-7-19-14-18-13-17(5-6-20(18)26-19)15-1-3-16(4-2-15)21(24)22-8-11-25-12-9-22/h1-6,13-14,23H,7-12H2 |
| InChIKey | XJUCYDGXRLBXEY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |