About 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol
2,2-di(cyclopenta-1,3-dien-1-yl)ethanol (PubChem CID 22274817) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol |
| PubChem CID | 22274817 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol |
| SMILES | OCC(C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C12H14O/c13-9-12(10-5-1-2-6-10)11-7-3-4-8-11/h1-5,7,12-13H,6,8-9H2 |
| InChIKey | ZULZBJKEDBQBTH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol?
The IUPAC name of 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol (CID 22274817) is 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol.
What is the SMILES notation for 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol?
The canonical SMILES for 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol is OCC(C1=CC=CC1)C1=CC=CC1.
What is the InChIKey of 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol?
The InChIKey is ZULZBJKEDBQBTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O/c13-9-12(10-5-1-2-6-10)11-7-3-4-8-11/h1-5,7,12-13H,6,8-9H2.
What are the key properties of 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol?
2,2-di(cyclopenta-1,3-dien-1-yl)ethanol has a molecular weight of 174.24 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-di(cyclopenta-1,3-dien-1-yl)ethanol is sourced from PubChem (CID 22274817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).