C26H25ClFN3O3S — CID 22275486
4-chloro-N-(4-fluorophenyl)-N-[1-[2-(3-imidazol-1-ylpropoxy)phenyl]ethyl]benzenesulfonamide (PubChem CID 22275486) has the molecular formula C26H25ClFN3O3S and a molecular weight of 514.02 g/mol. Its IUPAC name is 4-chloro-N-(4-fluorophenyl)-N-[1-[2-(3-imidazol-1-ylpropoxy)phenyl]ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(4-fluorophenyl)-N-[1-[2-(3-imidazol-1-ylpropoxy)phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22275486 |
| Molecular Formula | C26H25ClFN3O3S |
| Molecular Weight | 514.02 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 4-chloro-N-(4-fluorophenyl)-N-[1-[2-(3-imidazol-1-ylpropoxy)phenyl]ethyl]benzenesulfonamide |
| SMILES | CC(c1ccccc1OCCCn1ccnc1)N(c1ccc(F)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H25ClFN3O3S/c1-20(25-5-2-3-6-26(25)34-18-4-16-30-17-15-29-19-30)31(23-11-9-22(28)10-12-23)35(32,33)24-13-7-21(27)8-14-24/h2-3,5-15,17,19-20H,4,16,18H2,1H3 |
| InChIKey | OZUWVQGRIIAMOM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.02 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|