C32H37N3O7S — CID 22276787
2-[7-[4-(4-ethylphenoxy)phenyl]-1,1-dioxo-4-(pyridine-2-carbonyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 22276787) has the molecular formula C32H37N3O7S and a molecular weight of 607.73 g/mol. Its IUPAC name is 2-[7-[4-(4-ethylphenoxy)phenyl]-1,1-dioxo-4-(pyridine-2-carbonyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[7-[4-(4-ethylphenoxy)phenyl]-1,1-dioxo-4-(pyridine-2-carbonyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 22276787 |
| Molecular Formula | C32H37N3O7S |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | 2-[7-[4-(4-ethylphenoxy)phenyl]-1,1-dioxo-4-(pyridine-2-carbonyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | CCc1ccc(Oc2ccc(C3(CC(=O)NOC4CCCCO4)CCN(C(=O)c4ccccn4)CCS3(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C32H37N3O7S/c1-2-24-9-13-26(14-10-24)41-27-15-11-25(12-16-27)32(23-29(36)34-42-30-8-4-6-21-40-30)17-19-35(20-22-43(32,38)39)31(37)28-7-3-5-18-33-28/h3,5,7,9-16,18,30H,2,4,6,8,17,19-23H2,1H3,(H,34,36) |
| InChIKey | CTEWIEFYQNRRIX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|