C31H33N3O6S2 — CID 22276902
2-[4-benzoyl-7-[5-[4-(cyanomethyl)phenyl]thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 22276902) has the molecular formula C31H33N3O6S2 and a molecular weight of 607.75 g/mol. Its IUPAC name is 2-[4-benzoyl-7-[5-[4-(cyanomethyl)phenyl]thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[4-benzoyl-7-[5-[4-(cyanomethyl)phenyl]thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 22276902 |
| Molecular Formula | C31H33N3O6S2 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | 2-[4-benzoyl-7-[5-[4-(cyanomethyl)phenyl]thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | N#CCc1ccc(-c2ccc(C3(CC(=O)NOC4CCCCO4)CCN(C(=O)c4ccccc4)CCS3(=O)=O)s2)cc1 |
| InChI | InChI=1S/C31H33N3O6S2/c32-17-15-23-9-11-24(12-10-23)26-13-14-27(41-26)31(22-28(35)33-40-29-8-4-5-20-39-29)16-18-34(19-21-42(31,37)38)30(36)25-6-2-1-3-7-25/h1-3,6-7,9-14,29H,4-5,8,15-16,18-22H2,(H,33,35) |
| InChIKey | GUCISTIDYLXBIL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|