C26H27N3O6S — CID 22277060
N-hydroxy-2-[7-[4-(4-methylphenoxy)phenyl]-1,1-dioxo-4-(pyridine-2-carbonyl)-1,4-thiazepan-7-yl]acetamide (PubChem CID 22277060) has the molecular formula C26H27N3O6S and a molecular weight of 509.58 g/mol. Its IUPAC name is N-hydroxy-2-[7-[4-(4-methylphenoxy)phenyl]-1,1-dioxo-4-(pyridine-2-carbonyl)-1,4-thiazepan-7-yl]acetamide.
| Compound Name | N-hydroxy-2-[7-[4-(4-methylphenoxy)phenyl]-1,1-dioxo-4-(pyridine-2-carbonyl)-1,4-thiazepan-7-yl]acetamide |
|---|---|
| PubChem CID | 22277060 |
| Molecular Formula | C26H27N3O6S |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-hydroxy-2-[7-[4-(4-methylphenoxy)phenyl]-1,1-dioxo-4-(pyridine-2-carbonyl)-1,4-thiazepan-7-yl]acetamide |
| SMILES | Cc1ccc(Oc2ccc(C3(CC(=O)NO)CCN(C(=O)c4ccccn4)CCS3(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C26H27N3O6S/c1-19-5-9-21(10-6-19)35-22-11-7-20(8-12-22)26(18-24(30)28-32)13-15-29(16-17-36(26,33)34)25(31)23-4-2-3-14-27-23/h2-12,14,32H,13,15-18H2,1H3,(H,28,30) |
| InChIKey | SQCHRYGITVWAKR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|