C19H28BrN3O6S2 — CID 22277122
7-(5-bromothiophen-2-yl)-N-ethyl-7-[2-(oxan-2-yloxyamino)-2-oxoethyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide (PubChem CID 22277122) has the molecular formula C19H28BrN3O6S2 and a molecular weight of 538.49 g/mol. Its IUPAC name is 7-(5-bromothiophen-2-yl)-N-ethyl-7-[2-(oxan-2-yloxyamino)-2-oxoethyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide.
| Compound Name | 7-(5-bromothiophen-2-yl)-N-ethyl-7-[2-(oxan-2-yloxyamino)-2-oxoethyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 22277122 |
| Molecular Formula | C19H28BrN3O6S2 |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | 7-(5-bromothiophen-2-yl)-N-ethyl-7-[2-(oxan-2-yloxyamino)-2-oxoethyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide |
| SMILES | CCNC(=O)N1CCC(CC(=O)NOC2CCCCO2)(c2ccc(Br)s2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C19H28BrN3O6S2/c1-2-21-18(25)23-9-8-19(31(26,27)12-10-23,14-6-7-15(20)30-14)13-16(24)22-29-17-5-3-4-11-28-17/h6-7,17H,2-5,8-13H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | DIFRICDCGFHRPG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|