C24H23N5O6S2 — CID 22277142
N-hydroxy-2-[7-[5-[4-(1,3-oxazol-5-yl)phenyl]thiophen-2-yl]-1,1-dioxo-4-(1H-pyrazole-4-carbonyl)-1,4-thiazepan-7-yl]acetamide (PubChem CID 22277142) has the molecular formula C24H23N5O6S2 and a molecular weight of 541.61 g/mol. Its IUPAC name is N-hydroxy-2-[7-[5-[4-(1,3-oxazol-5-yl)phenyl]thiophen-2-yl]-1,1-dioxo-4-(1H-pyrazole-4-carbonyl)-1,4-thiazepan-7-yl]acetamide.
| Compound Name | N-hydroxy-2-[7-[5-[4-(1,3-oxazol-5-yl)phenyl]thiophen-2-yl]-1,1-dioxo-4-(1H-pyrazole-4-carbonyl)-1,4-thiazepan-7-yl]acetamide |
|---|---|
| PubChem CID | 22277142 |
| Molecular Formula | C24H23N5O6S2 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | N-hydroxy-2-[7-[5-[4-(1,3-oxazol-5-yl)phenyl]thiophen-2-yl]-1,1-dioxo-4-(1H-pyrazole-4-carbonyl)-1,4-thiazepan-7-yl]acetamide |
| SMILES | O=C(CC1(c2ccc(-c3ccc(-c4cnco4)cc3)s2)CCN(C(=O)c2cn[nH]c2)CCS1(=O)=O)NO |
| InChI | InChI=1S/C24H23N5O6S2/c30-22(28-32)11-24(7-8-29(9-10-37(24,33)34)23(31)18-12-26-27-13-18)21-6-5-20(36-21)17-3-1-16(2-4-17)19-14-25-15-35-19/h1-6,12-15,32H,7-11H2,(H,26,27)(H,28,30) |
| InChIKey | LCEJSTKAQGTTQB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 158.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|