C12H17BrN2O6S3 — CID 22277148
2-[7-(5-bromothiophen-2-yl)-4-methylsulfonyl-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide (PubChem CID 22277148) has the molecular formula C12H17BrN2O6S3 and a molecular weight of 461.38 g/mol. Its IUPAC name is 2-[7-(5-bromothiophen-2-yl)-4-methylsulfonyl-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide.
| Compound Name | 2-[7-(5-bromothiophen-2-yl)-4-methylsulfonyl-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 22277148 |
| Molecular Formula | C12H17BrN2O6S3 |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 459.94 |
| IUPAC Name | 2-[7-(5-bromothiophen-2-yl)-4-methylsulfonyl-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide |
| SMILES | CS(=O)(=O)N1CCC(CC(=O)NO)(c2ccc(Br)s2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C12H17BrN2O6S3/c1-23(18,19)15-5-4-12(8-11(16)14-17,24(20,21)7-6-15)9-2-3-10(13)22-9/h2-3,17H,4-8H2,1H3,(H,14,16) |
| InChIKey | UBLROVCLULTQFN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|