About oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine
oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine (PubChem CID 22277261) has the molecular formula C15H15F3N2O5
and a molecular weight of 360.29 g/mol. Its IUPAC name is oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine.
Molecular Properties
| Compound Name | oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine |
| PubChem CID | 22277261 |
| Molecular Formula | C15H15F3N2O5 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine |
| SMILES | Cc1coc2c(N3CCNCC3)c(F)c(F)c(F)c12.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H13F3N2O.C2H2O4/c1-7-6-19-13-8(7)9(14)10(15)11(16)12(13)18-4-2-17-3-5-18;3-1(4)2(5)6/h6,17H,2-5H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | BIIRDODUFFIJHH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine?
The IUPAC name of oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine (CID 22277261) is oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine.
What is the SMILES notation for oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine?
The canonical SMILES for oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine is Cc1coc2c(N3CCNCC3)c(F)c(F)c(F)c12.O=C(O)C(=O)O.
What is the InChIKey of oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine?
The InChIKey is BIIRDODUFFIJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N2O.C2H2O4/c1-7-6-19-13-8(7)9(14)10(15)11(16)12(13)18-4-2-17-3-5-18;3-1(4)2(5)6/h6,17H,2-5H2,1H3;(H,3,4)(H,5,6).
What are the key properties of oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine?
oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine has a molecular weight of 360.29 g/mol, XLogP of 1.72, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;1-(4,5,6-trifluoro-3-methyl-1-benzofuran-7-yl)piperazine is sourced from PubChem (CID 22277261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).