C22H20Cl2FN3O6S — CID 22277586
7-[4-(3,5-dichloro-2-hydroxyphenyl)sulfonylpiperazin-1-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 22277586) has the molecular formula C22H20Cl2FN3O6S and a molecular weight of 544.39 g/mol. Its IUPAC name is 7-[4-(3,5-dichloro-2-hydroxyphenyl)sulfonylpiperazin-1-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[4-(3,5-dichloro-2-hydroxyphenyl)sulfonylpiperazin-1-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 22277586 |
| Molecular Formula | C22H20Cl2FN3O6S |
| Molecular Weight | 544.39 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | 7-[4-(3,5-dichloro-2-hydroxyphenyl)sulfonylpiperazin-1-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(S(=O)(=O)c4cc(Cl)cc(Cl)c4O)CC3)cc21 |
| InChI | InChI=1S/C22H20Cl2FN3O6S/c1-2-26-11-14(22(31)32)20(29)13-9-16(25)18(10-17(13)26)27-3-5-28(6-4-27)35(33,34)19-8-12(23)7-15(24)21(19)30/h7-11,30H,2-6H2,1H3,(H,31,32) |
| InChIKey | PXVFDMNUYWXRSW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|